About [1-(furan-2-ylmethyl)-2,2-dimethylpiperidin-3-yl]methanamine
[1-(furan-2-ylmethyl)-2,2-dimethylpiperidin-3-yl]methanamine (PubChem CID 117019699) has the molecular formula C13H22N2O
and a molecular weight of 222.33 g/mol. Its IUPAC name is [1-(furan-2-ylmethyl)-2,2-dimethylpiperidin-3-yl]methanamine.
Molecular Properties
| Compound Name | [1-(furan-2-ylmethyl)-2,2-dimethylpiperidin-3-yl]methanamine |
| PubChem CID | 117019699 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | [1-(furan-2-ylmethyl)-2,2-dimethylpiperidin-3-yl]methanamine |
| SMILES | CC1(C)C(CN)CCCN1Cc1ccco1 |
| InChI | InChI=1S/C13H22N2O/c1-13(2)11(9-14)5-3-7-15(13)10-12-6-4-8-16-12/h4,6,8,11H,3,5,7,9-10,14H2,1-2H3 |
| InChIKey | MVZCMBUUWIXFLO-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 42.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-(furan-2-ylmethyl)-2,2-dimethylpiperidin-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(furan-2-ylmethyl)-2,2-dimethylpiperidin-3-yl]methanamine?
The IUPAC name of [1-(furan-2-ylmethyl)-2,2-dimethylpiperidin-3-yl]methanamine (CID 117019699) is [1-(furan-2-ylmethyl)-2,2-dimethylpiperidin-3-yl]methanamine.
What is the SMILES notation for [1-(furan-2-ylmethyl)-2,2-dimethylpiperidin-3-yl]methanamine?
The canonical SMILES for [1-(furan-2-ylmethyl)-2,2-dimethylpiperidin-3-yl]methanamine is CC1(C)C(CN)CCCN1Cc1ccco1.
What is the InChIKey of [1-(furan-2-ylmethyl)-2,2-dimethylpiperidin-3-yl]methanamine?
The InChIKey is MVZCMBUUWIXFLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2O/c1-13(2)11(9-14)5-3-7-15(13)10-12-6-4-8-16-12/h4,6,8,11H,3,5,7,9-10,14H2,1-2H3.
What are the key properties of [1-(furan-2-ylmethyl)-2,2-dimethylpiperidin-3-yl]methanamine?
[1-(furan-2-ylmethyl)-2,2-dimethylpiperidin-3-yl]methanamine has a molecular weight of 222.33 g/mol, XLogP of 2.23, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(furan-2-ylmethyl)-2,2-dimethylpiperidin-3-yl]methanamine is sourced from PubChem (CID 117019699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).