C12H20N2O — CID 91664788
1-(furan-2-ylmethyl)-N,N-dimethylpiperidin-4-amine (PubChem CID 91664788) has the molecular formula C12H20N2O and a molecular weight of 208.31 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-N,N-dimethylpiperidin-4-amine.
| Compound Name | 1-(furan-2-ylmethyl)-N,N-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 91664788 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 1-(furan-2-ylmethyl)-N,N-dimethylpiperidin-4-amine |
| SMILES | CN(C)C1CCN(Cc2ccco2)CC1 |
| InChI | InChI=1S/C12H20N2O/c1-13(2)11-5-7-14(8-6-11)10-12-4-3-9-15-12/h3-4,9,11H,5-8,10H2,1-2H3 |
| InChIKey | CNGXDLZTEVXFDI-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 19.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |