About 1-(furan-2-ylmethyl)-4-methylpiperazine;methanamine
1-(furan-2-ylmethyl)-4-methylpiperazine;methanamine (PubChem CID 162740974) has the molecular formula C11H21N3O
and a molecular weight of 211.31 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-4-methylpiperazine;methanamine.
Molecular Properties
| Compound Name | 1-(furan-2-ylmethyl)-4-methylpiperazine;methanamine |
| PubChem CID | 162740974 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | 1-(furan-2-ylmethyl)-4-methylpiperazine;methanamine |
| SMILES | CN.CN1CCN(Cc2ccco2)CC1 |
| InChI | InChI=1S/C10H16N2O.CH5N/c1-11-4-6-12(7-5-11)9-10-3-2-8-13-10;1-2/h2-3,8H,4-7,9H2,1H3;2H2,1H3 |
| InChIKey | SRKYEKOCHJKWMO-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 45.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(furan-2-ylmethyl)-4-methylpiperazine;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(furan-2-ylmethyl)-4-methylpiperazine;methanamine?
The IUPAC name of 1-(furan-2-ylmethyl)-4-methylpiperazine;methanamine (CID 162740974) is 1-(furan-2-ylmethyl)-4-methylpiperazine;methanamine.
What is the SMILES notation for 1-(furan-2-ylmethyl)-4-methylpiperazine;methanamine?
The canonical SMILES for 1-(furan-2-ylmethyl)-4-methylpiperazine;methanamine is CN.CN1CCN(Cc2ccco2)CC1.
What is the InChIKey of 1-(furan-2-ylmethyl)-4-methylpiperazine;methanamine?
The InChIKey is SRKYEKOCHJKWMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O.CH5N/c1-11-4-6-12(7-5-11)9-10-3-2-8-13-10;1-2/h2-3,8H,4-7,9H2,1H3;2H2,1H3.
What are the key properties of 1-(furan-2-ylmethyl)-4-methylpiperazine;methanamine?
1-(furan-2-ylmethyl)-4-methylpiperazine;methanamine has a molecular weight of 211.31 g/mol, XLogP of 0.60, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(furan-2-ylmethyl)-4-methylpiperazine;methanamine is sourced from PubChem (CID 162740974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).