C11H19ClN2O — CID 86253291
1-(furan-2-ylmethyl)-N-methylpiperidin-4-amine;hydrochloride (PubChem CID 86253291) has the molecular formula C11H19ClN2O and a molecular weight of 230.74 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-N-methylpiperidin-4-amine;hydrochloride.
| Compound Name | 1-(furan-2-ylmethyl)-N-methylpiperidin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 86253291 |
| Molecular Formula | C11H19ClN2O |
| Molecular Weight | 230.74 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 1-(furan-2-ylmethyl)-N-methylpiperidin-4-amine;hydrochloride |
| SMILES | CNC1CCN(Cc2ccco2)CC1.Cl |
| InChI | InChI=1S/C11H18N2O.ClH/c1-12-10-4-6-13(7-5-10)9-11-3-2-8-14-11;/h2-3,8,10,12H,4-7,9H2,1H3;1H |
| InChIKey | YMFOAXMCWQGARY-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.74 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |