C11H17NO — CID 130727430
3-ethyl-1-(furan-2-ylmethyl)pyrrolidine (PubChem CID 130727430) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is 3-ethyl-1-(furan-2-ylmethyl)pyrrolidine.
| Compound Name | 3-ethyl-1-(furan-2-ylmethyl)pyrrolidine |
|---|---|
| PubChem CID | 130727430 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 3-ethyl-1-(furan-2-ylmethyl)pyrrolidine |
| SMILES | CCC1CCN(Cc2ccco2)C1 |
| InChI | InChI=1S/C11H17NO/c1-2-10-5-6-12(8-10)9-11-4-3-7-13-11/h3-4,7,10H,2,5-6,8-9H2,1H3 |
| InChIKey | HUJFKHOYJHBZGI-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |