C9H16Cl2N2O — CID 53422470
1-(furan-2-ylmethyl)pyrrolidin-3-amine;dihydrochloride (PubChem CID 53422470) has the molecular formula C9H16Cl2N2O and a molecular weight of 239.15 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)pyrrolidin-3-amine;dihydrochloride.
| Compound Name | 1-(furan-2-ylmethyl)pyrrolidin-3-amine;dihydrochloride |
|---|---|
| PubChem CID | 53422470 |
| Molecular Formula | C9H16Cl2N2O |
| Molecular Weight | 239.15 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 1-(furan-2-ylmethyl)pyrrolidin-3-amine;dihydrochloride |
| SMILES | Cl.Cl.NC1CCN(Cc2ccco2)C1 |
| InChI | InChI=1S/C9H14N2O.2ClH/c10-8-3-4-11(6-8)7-9-2-1-5-12-9;;/h1-2,5,8H,3-4,6-7,10H2;2*1H |
| InChIKey | UDORKZUYROOTGC-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 42.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.15 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |