C9H13NO3 — CID 79420188
(3R,4S)-1-(furan-2-ylmethyl)pyrrolidine-3,4-diol (PubChem CID 79420188) has the molecular formula C9H13NO3 and a molecular weight of 183.21 g/mol. Its IUPAC name is (3R,4S)-1-(furan-2-ylmethyl)pyrrolidine-3,4-diol.
| Compound Name | (3R,4S)-1-(furan-2-ylmethyl)pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 79420188 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | (3R,4S)-1-(furan-2-ylmethyl)pyrrolidine-3,4-diol |
| SMILES | O[C@@H]1CN(Cc2ccco2)C[C@@H]1O |
| InChI | InChI=1S/C9H13NO3/c11-8-5-10(6-9(8)12)4-7-2-1-3-13-7/h1-3,8-9,11-12H,4-6H2/t8-,9+ |
| InChIKey | FSJGPKFWUCOMLM-DTORHVGOSA-N |
| XLogP | -0.18 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |