C11H18Cl2N2O — CID 155834911
(3aS,6aS)-5-(furan-2-ylmethyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole;dihydrochloride (PubChem CID 155834911) has the molecular formula C11H18Cl2N2O and a molecular weight of 265.18 g/mol. Its IUPAC name is (3aS,6aS)-5-(furan-2-ylmethyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole;dihydrochloride.
| Compound Name | (3aS,6aS)-5-(furan-2-ylmethyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole;dihydrochloride |
|---|---|
| PubChem CID | 155834911 |
| Molecular Formula | C11H18Cl2N2O |
| Molecular Weight | 265.18 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | (3aS,6aS)-5-(furan-2-ylmethyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole;dihydrochloride |
| SMILES | Cl.Cl.c1coc(CN2C[C@@H]3CCN[C@@H]3C2)c1 |
| InChI | InChI=1S/C11H16N2O.2ClH/c1-2-10(14-5-1)7-13-6-9-3-4-12-11(9)8-13;;/h1-2,5,9,11-12H,3-4,6-8H2;2*1H/t9-,11+;;/m0../s1 |
| InChIKey | SQVKWIAEJVSNPV-NAUXGDFUSA-N |
| XLogP | 1.92 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.18 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |