C16H20N2O — CID 103887013
(4aS,7aS)-6-(1-benzofuran-2-ylmethyl)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine (PubChem CID 103887013) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is (4aS,7aS)-6-(1-benzofuran-2-ylmethyl)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine.
| Compound Name | (4aS,7aS)-6-(1-benzofuran-2-ylmethyl)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 103887013 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | (4aS,7aS)-6-(1-benzofuran-2-ylmethyl)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine |
| SMILES | c1ccc2oc(CN3C[C@@H]4CCCN[C@@H]4C3)cc2c1 |
| InChI | InChI=1S/C16H20N2O/c1-2-6-16-12(4-1)8-14(19-16)10-18-9-13-5-3-7-17-15(13)11-18/h1-2,4,6,8,13,15,17H,3,5,7,9-11H2/t13-,15+/m0/s1 |
| InChIKey | ZDVAMLDTSBSJOB-DZGCQCFKSA-N |
| XLogP | 2.62 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |