C17H21N3 — CID 102678718
4-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-ylmethyl)isoquinoline (PubChem CID 102678718) has the molecular formula C17H21N3 and a molecular weight of 267.38 g/mol. Its IUPAC name is 4-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-ylmethyl)isoquinoline.
| Compound Name | 4-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-ylmethyl)isoquinoline |
|---|---|
| PubChem CID | 102678718 |
| Molecular Formula | C17H21N3 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 4-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-ylmethyl)isoquinoline |
| SMILES | c1ccc2c(CN3CC4CCCNC4C3)cncc2c1 |
| InChI | InChI=1S/C17H21N3/c1-2-6-16-13(4-1)8-18-9-15(16)11-20-10-14-5-3-7-19-17(14)12-20/h1-2,4,6,8-9,14,17,19H,3,5,7,10-12H2 |
| InChIKey | DXLMWFDTIFWGFI-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |