C13H18N2O3 — CID 102682029
2-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-ylmethyl)-5-hydroxypyran-4-one (PubChem CID 102682029) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is 2-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-ylmethyl)-5-hydroxypyran-4-one.
| Compound Name | 2-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-ylmethyl)-5-hydroxypyran-4-one |
|---|---|
| PubChem CID | 102682029 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 2-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-ylmethyl)-5-hydroxypyran-4-one |
| SMILES | O=c1cc(CN2CC3CCCNC3C2)occ1O |
| InChI | InChI=1S/C13H18N2O3/c16-12-4-10(18-8-13(12)17)6-15-5-9-2-1-3-14-11(9)7-15/h4,8-9,11,14,17H,1-3,5-7H2 |
| InChIKey | MROLATYDCOOLPZ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 65.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |