C22H30NSi — CID 86042658
CID 86042658 (PubChem CID 86042658) has the molecular formula C22H30NSi and a molecular weight of 336.57 g/mol.
| Compound Name | CID 86042658 |
|---|---|
| PubChem CID | 86042658 |
| Molecular Formula | C22H30NSi |
| Molecular Weight | 336.57 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | — |
| SMILES | C[Si](CC1CCCN(Cc2ccccc2)C1(C)C)c1ccccc1 |
| InChI | InChI=1S/C22H30NSi/c1-22(2)20(18-24(3)21-14-8-5-9-15-21)13-10-16-23(22)17-19-11-6-4-7-12-19/h4-9,11-12,14-15,20H,10,13,16-18H2,1-3H3 |
| InChIKey | CKGQRTGEHYALJR-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.57 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|