C16H23N — CID 102412356
(5S,9S)-1-benzyl-9-methyl-1-azaspiro[4.4]nonane (PubChem CID 102412356) has the molecular formula C16H23N and a molecular weight of 229.37 g/mol. Its IUPAC name is (5S,9S)-1-benzyl-9-methyl-1-azaspiro[4.4]nonane.
| Compound Name | (5S,9S)-1-benzyl-9-methyl-1-azaspiro[4.4]nonane |
|---|---|
| PubChem CID | 102412356 |
| Molecular Formula | C16H23N |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | (5S,9S)-1-benzyl-9-methyl-1-azaspiro[4.4]nonane |
| SMILES | C[C@H]1CCC[C@]12CCCN2Cc1ccccc1 |
| InChI | InChI=1S/C16H23N/c1-14-7-5-10-16(14)11-6-12-17(16)13-15-8-3-2-4-9-15/h2-4,8-9,14H,5-7,10-13H2,1H3/t14-,16-/m0/s1 |
| InChIKey | VVPDSUPEWQRNGA-HOCLYGCPSA-N |
| XLogP | 3.84 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |