C18H25N — CID 102412352
(4S,5R)-6-benzyl-4-ethenyl-6-azaspiro[4.5]decane (PubChem CID 102412352) has the molecular formula C18H25N and a molecular weight of 255.41 g/mol. Its IUPAC name is (4S,5R)-6-benzyl-4-ethenyl-6-azaspiro[4.5]decane.
| Compound Name | (4S,5R)-6-benzyl-4-ethenyl-6-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 102412352 |
| Molecular Formula | C18H25N |
| Molecular Weight | 255.41 g/mol |
| Exact Mass | 255.20 |
| IUPAC Name | (4S,5R)-6-benzyl-4-ethenyl-6-azaspiro[4.5]decane |
| SMILES | C=C[C@@H]1CCC[C@@]12CCCCN2Cc1ccccc1 |
| InChI | InChI=1S/C18H25N/c1-2-17-11-8-13-18(17)12-6-7-14-19(18)15-16-9-4-3-5-10-16/h2-5,9-10,17H,1,6-8,11-15H2/t17-,18+/m1/s1 |
| InChIKey | MRGCBFJGTHTMQE-MSOLQXFVSA-N |
| XLogP | 4.40 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.41 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|