C20H23N — CID 4304758
1,2-dibenzyl-2-ethenylpyrrolidine (PubChem CID 4304758) has the molecular formula C20H23N and a molecular weight of 277.41 g/mol. Its IUPAC name is 1,2-dibenzyl-2-ethenylpyrrolidine.
| Compound Name | 1,2-dibenzyl-2-ethenylpyrrolidine |
|---|---|
| PubChem CID | 4304758 |
| Molecular Formula | C20H23N |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | 1,2-dibenzyl-2-ethenylpyrrolidine |
| SMILES | C=CC1(Cc2ccccc2)CCCN1Cc1ccccc1 |
| InChI | InChI=1S/C20H23N/c1-2-20(16-18-10-5-3-6-11-18)14-9-15-21(20)17-19-12-7-4-8-13-19/h2-8,10-13H,1,9,14-17H2 |
| InChIKey | CXEZANFIOGSBAO-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|