C14H18NO2- — CID 71434868
1-benzyl-2-methylpiperidine-2-carboxylate (PubChem CID 71434868) has the molecular formula C14H18NO2- and a molecular weight of 232.30 g/mol. Its IUPAC name is 1-benzyl-2-methylpiperidine-2-carboxylate.
| Compound Name | 1-benzyl-2-methylpiperidine-2-carboxylate |
|---|---|
| PubChem CID | 71434868 |
| Molecular Formula | C14H18NO2- |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 1-benzyl-2-methylpiperidine-2-carboxylate |
| SMILES | CC1(C(=O)[O-])CCCCN1Cc1ccccc1 |
| InChI | InChI=1S/C14H19NO2/c1-14(13(16)17)9-5-6-10-15(14)11-12-7-3-2-4-8-12/h2-4,7-8H,5-6,9-11H2,1H3,(H,16,17)/p-1 |
| InChIKey | UBTXVNRZRAHWCN-UHFFFAOYSA-M |
| XLogP | 1.18 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |