C15H20LiNO2 — CID 159928526
lithium (2R)-2-methyl-1-[(4-methylphenyl)methyl]piperidine-2-carboxylate (PubChem CID 159928526) has the molecular formula C15H20LiNO2 and a molecular weight of 253.27 g/mol. Its IUPAC name is lithium (2R)-2-methyl-1-[(4-methylphenyl)methyl]piperidine-2-carboxylate.
| Compound Name | lithium (2R)-2-methyl-1-[(4-methylphenyl)methyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 159928526 |
| Molecular Formula | C15H20LiNO2 |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | lithium (2R)-2-methyl-1-[(4-methylphenyl)methyl]piperidine-2-carboxylate |
| SMILES | Cc1ccc(CN2CCCC[C@]2(C)C(=O)[O-])cc1.[Li+] |
| InChI | InChI=1S/C15H21NO2.Li/c1-12-5-7-13(8-6-12)11-16-10-4-3-9-15(16,2)14(17)18;/h5-8H,3-4,9-11H2,1-2H3,(H,17,18);/q;+1/p-1/t15-;/m1./s1 |
| InChIKey | GEBWDZMMNZGXCO-XFULWGLBSA-M |
| XLogP | -1.51 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |