C12H22N2 — CID 130581230
4-(cyclopropylmethyl)-2,3,4a,5,6,7,8,8a-octahydro-1H-quinoxaline (PubChem CID 130581230) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is 4-(cyclopropylmethyl)-2,3,4a,5,6,7,8,8a-octahydro-1H-quinoxaline.
| Compound Name | 4-(cyclopropylmethyl)-2,3,4a,5,6,7,8,8a-octahydro-1H-quinoxaline |
|---|---|
| PubChem CID | 130581230 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | 4-(cyclopropylmethyl)-2,3,4a,5,6,7,8,8a-octahydro-1H-quinoxaline |
| SMILES | C1CCC2C(C1)NCCN2CC1CC1 |
| InChI | InChI=1S/C12H22N2/c1-2-4-12-11(3-1)13-7-8-14(12)9-10-5-6-10/h10-13H,1-9H2 |
| InChIKey | MMSKDCARIHFAOO-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |