C11H23N3 — CID 102571338
2-(1,2,3,4a,5,6,7,7a-octahydrocyclopenta[b]pyrazin-4-yl)-N,N-dimethylethanamine (PubChem CID 102571338) has the molecular formula C11H23N3 and a molecular weight of 197.33 g/mol. Its IUPAC name is 2-(1,2,3,4a,5,6,7,7a-octahydrocyclopenta[b]pyrazin-4-yl)-N,N-dimethylethanamine.
| Compound Name | 2-(1,2,3,4a,5,6,7,7a-octahydrocyclopenta[b]pyrazin-4-yl)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 102571338 |
| Molecular Formula | C11H23N3 |
| Molecular Weight | 197.33 g/mol |
| Exact Mass | 197.19 |
| IUPAC Name | 2-(1,2,3,4a,5,6,7,7a-octahydrocyclopenta[b]pyrazin-4-yl)-N,N-dimethylethanamine |
| SMILES | CN(C)CCN1CCNC2CCCC21 |
| InChI | InChI=1S/C11H23N3/c1-13(2)8-9-14-7-6-12-10-4-3-5-11(10)14/h10-12H,3-9H2,1-2H3 |
| InChIKey | JOQAZVHMACWVIE-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.33 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |