C12H22N2 — CID 130581238
4-[(E)-but-2-enyl]-2,3,4a,5,6,7,8,8a-octahydro-1H-quinoxaline (PubChem CID 130581238) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is 4-[(E)-but-2-enyl]-2,3,4a,5,6,7,8,8a-octahydro-1H-quinoxaline.
| Compound Name | 4-[(E)-but-2-enyl]-2,3,4a,5,6,7,8,8a-octahydro-1H-quinoxaline |
|---|---|
| PubChem CID | 130581238 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | 4-[(E)-but-2-enyl]-2,3,4a,5,6,7,8,8a-octahydro-1H-quinoxaline |
| SMILES | C/C=C/CN1CCNC2CCCCC21 |
| InChI | InChI=1S/C12H22N2/c1-2-3-9-14-10-8-13-11-6-4-5-7-12(11)14/h2-3,11-13H,4-10H2,1H3/b3-2+ |
| InChIKey | BIYSPJPQPZOBIX-NSCUHMNNSA-N |
| XLogP | 1.78 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|