C13H19BrN2S — CID 62273179
1-[(5-bromothiophen-2-yl)methyl]-2-pyrrolidin-2-ylpyrrolidine (PubChem CID 62273179) has the molecular formula C13H19BrN2S and a molecular weight of 315.28 g/mol. Its IUPAC name is 1-[(5-bromothiophen-2-yl)methyl]-2-pyrrolidin-2-ylpyrrolidine.
| Compound Name | 1-[(5-bromothiophen-2-yl)methyl]-2-pyrrolidin-2-ylpyrrolidine |
|---|---|
| PubChem CID | 62273179 |
| Molecular Formula | C13H19BrN2S |
| Molecular Weight | 315.28 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 1-[(5-bromothiophen-2-yl)methyl]-2-pyrrolidin-2-ylpyrrolidine |
| SMILES | Brc1ccc(CN2CCCC2C2CCCN2)s1 |
| InChI | InChI=1S/C13H19BrN2S/c14-13-6-5-10(17-13)9-16-8-2-4-12(16)11-3-1-7-15-11/h5-6,11-12,15H,1-4,7-9H2 |
| InChIKey | AFXZQUDUMHHPRB-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.28 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |