C10H16BrClN2S — CID 119927224
[1-[(5-bromothiophen-2-yl)methyl]pyrrolidin-2-yl]methanamine;hydrochloride (PubChem CID 119927224) has the molecular formula C10H16BrClN2S and a molecular weight of 311.68 g/mol. Its IUPAC name is [1-[(5-bromothiophen-2-yl)methyl]pyrrolidin-2-yl]methanamine;hydrochloride.
| Compound Name | [1-[(5-bromothiophen-2-yl)methyl]pyrrolidin-2-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 119927224 |
| Molecular Formula | C10H16BrClN2S |
| Molecular Weight | 311.68 g/mol |
| Exact Mass | 309.99 |
| IUPAC Name | [1-[(5-bromothiophen-2-yl)methyl]pyrrolidin-2-yl]methanamine;hydrochloride |
| SMILES | Cl.NCC1CCCN1Cc1ccc(Br)s1 |
| InChI | InChI=1S/C10H15BrN2S.ClH/c11-10-4-3-9(14-10)7-13-5-1-2-8(13)6-12;/h3-4,8H,1-2,5-7,12H2;1H |
| InChIKey | OLASIGOCGPCLFB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.68 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |