C13H14Cl3NO2 — CID 82183336
2-[1-[(2,3,6-trichlorophenyl)methyl]pyrrolidin-2-yl]acetic acid (PubChem CID 82183336) has the molecular formula C13H14Cl3NO2 and a molecular weight of 322.62 g/mol. Its IUPAC name is 2-[1-[(2,3,6-trichlorophenyl)methyl]pyrrolidin-2-yl]acetic acid.
| Compound Name | 2-[1-[(2,3,6-trichlorophenyl)methyl]pyrrolidin-2-yl]acetic acid |
|---|---|
| PubChem CID | 82183336 |
| Molecular Formula | C13H14Cl3NO2 |
| Molecular Weight | 322.62 g/mol |
| Exact Mass | 321.01 |
| IUPAC Name | 2-[1-[(2,3,6-trichlorophenyl)methyl]pyrrolidin-2-yl]acetic acid |
| SMILES | O=C(O)CC1CCCN1Cc1c(Cl)ccc(Cl)c1Cl |
| InChI | InChI=1S/C13H14Cl3NO2/c14-10-3-4-11(15)13(16)9(10)7-17-5-1-2-8(17)6-12(18)19/h3-4,8H,1-2,5-7H2,(H,18,19) |
| InChIKey | DWKBXZQMFFSOCL-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.62 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|