C17H22N4O4 — CID 90333757
N-[5-[2-(4-acetylpiperazin-1-yl)-2-oxoethoxy]-2-aminophenyl]prop-2-enamide (PubChem CID 90333757) has the molecular formula C17H22N4O4 and a molecular weight of 346.39 g/mol. Its IUPAC name is N-[5-[2-(4-acetylpiperazin-1-yl)-2-oxoethoxy]-2-aminophenyl]prop-2-enamide.
| Compound Name | N-[5-[2-(4-acetylpiperazin-1-yl)-2-oxoethoxy]-2-aminophenyl]prop-2-enamide |
|---|---|
| PubChem CID | 90333757 |
| Molecular Formula | C17H22N4O4 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | N-[5-[2-(4-acetylpiperazin-1-yl)-2-oxoethoxy]-2-aminophenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(OCC(=O)N2CCN(C(C)=O)CC2)ccc1N |
| InChI | InChI=1S/C17H22N4O4/c1-3-16(23)19-15-10-13(4-5-14(15)18)25-11-17(24)21-8-6-20(7-9-21)12(2)22/h3-5,10H,1,6-9,11,18H2,2H3,(H,19,23) |
| InChIKey | YPKNRYQONLIEMD-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|