C17H23N3O4 — CID 146084564
3-[2-(4-acetyl-1,4-diazepan-1-yl)-2-oxoethoxy]-N-methylbenzamide (PubChem CID 146084564) has the molecular formula C17H23N3O4 and a molecular weight of 333.39 g/mol. Its IUPAC name is 3-[2-(4-acetyl-1,4-diazepan-1-yl)-2-oxoethoxy]-N-methylbenzamide.
| Compound Name | 3-[2-(4-acetyl-1,4-diazepan-1-yl)-2-oxoethoxy]-N-methylbenzamide |
|---|---|
| PubChem CID | 146084564 |
| Molecular Formula | C17H23N3O4 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 3-[2-(4-acetyl-1,4-diazepan-1-yl)-2-oxoethoxy]-N-methylbenzamide |
| SMILES | CNC(=O)c1cccc(OCC(=O)N2CCCN(C(C)=O)CC2)c1 |
| InChI | InChI=1S/C17H23N3O4/c1-13(21)19-7-4-8-20(10-9-19)16(22)12-24-15-6-3-5-14(11-15)17(23)18-2/h3,5-6,11H,4,7-10,12H2,1-2H3,(H,18,23) |
| InChIKey | ATELZRWXICMXAZ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |