C19H22N6O3 — CID 90333510
N-[2-amino-5-[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethoxy]phenyl]prop-2-enamide (PubChem CID 90333510) has the molecular formula C19H22N6O3 and a molecular weight of 382.42 g/mol. Its IUPAC name is N-[2-amino-5-[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethoxy]phenyl]prop-2-enamide.
| Compound Name | N-[2-amino-5-[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethoxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 90333510 |
| Molecular Formula | C19H22N6O3 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | N-[2-amino-5-[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethoxy]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(OCC(=O)N2CCN(c3ncccn3)CC2)ccc1N |
| InChI | InChI=1S/C19H22N6O3/c1-2-17(26)23-16-12-14(4-5-15(16)20)28-13-18(27)24-8-10-25(11-9-24)19-21-6-3-7-22-19/h2-7,12H,1,8-11,13,20H2,(H,23,26) |
| InChIKey | DROFQXSRRVBJRE-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|