C17H20N4O2 — CID 47072316
2-phenoxy-1-(4-pyrimidin-2-yl-1,4-diazepan-1-yl)ethanone (PubChem CID 47072316) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is 2-phenoxy-1-(4-pyrimidin-2-yl-1,4-diazepan-1-yl)ethanone.
| Compound Name | 2-phenoxy-1-(4-pyrimidin-2-yl-1,4-diazepan-1-yl)ethanone |
|---|---|
| PubChem CID | 47072316 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 2-phenoxy-1-(4-pyrimidin-2-yl-1,4-diazepan-1-yl)ethanone |
| SMILES | O=C(COc1ccccc1)N1CCCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C17H20N4O2/c22-16(14-23-15-6-2-1-3-7-15)20-10-5-11-21(13-12-20)17-18-8-4-9-19-17/h1-4,6-9H,5,10-14H2 |
| InChIKey | PIUNZZOENYMDBV-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |