C21H30N4O5 — CID 90333714
tert-butyl 4-[2-[4-amino-3-(prop-2-enoylamino)phenoxy]propanoyl]piperazine-1-carboxylate (PubChem CID 90333714) has the molecular formula C21H30N4O5 and a molecular weight of 418.49 g/mol. Its IUPAC name is tert-butyl 4-[2-[4-amino-3-(prop-2-enoylamino)phenoxy]propanoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[4-amino-3-(prop-2-enoylamino)phenoxy]propanoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 90333714 |
| Molecular Formula | C21H30N4O5 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | tert-butyl 4-[2-[4-amino-3-(prop-2-enoylamino)phenoxy]propanoyl]piperazine-1-carboxylate |
| SMILES | C=CC(=O)Nc1cc(OC(C)C(=O)N2CCN(C(=O)OC(C)(C)C)CC2)ccc1N |
| InChI | InChI=1S/C21H30N4O5/c1-6-18(26)23-17-13-15(7-8-16(17)22)29-14(2)19(27)24-9-11-25(12-10-24)20(28)30-21(3,4)5/h6-8,13-14H,1,9-12,22H2,2-5H3,(H,23,26) |
| InChIKey | POGCSGPWZHNUAA-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 114.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|