C19H27N3O4S — CID 123405182
tert-butyl 4-[2-methyl-4-(prop-2-enoylamino)phenyl]sulfinylpiperazine-1-carboxylate (PubChem CID 123405182) has the molecular formula C19H27N3O4S and a molecular weight of 393.51 g/mol. Its IUPAC name is tert-butyl 4-[2-methyl-4-(prop-2-enoylamino)phenyl]sulfinylpiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-methyl-4-(prop-2-enoylamino)phenyl]sulfinylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 123405182 |
| Molecular Formula | C19H27N3O4S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | tert-butyl 4-[2-methyl-4-(prop-2-enoylamino)phenyl]sulfinylpiperazine-1-carboxylate |
| SMILES | C=CC(=O)Nc1ccc(S(=O)N2CCN(C(=O)OC(C)(C)C)CC2)c(C)c1 |
| InChI | InChI=1S/C19H27N3O4S/c1-6-17(23)20-15-7-8-16(14(2)13-15)27(25)22-11-9-21(10-12-22)18(24)26-19(3,4)5/h6-8,13H,1,9-12H2,2-5H3,(H,20,23) |
| InChIKey | JALAZJVVJKAPEZ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|