C19H24FN3O5 — CID 166405282
tert-butyl 2-[[4-fluoro-3-(prop-2-enoylamino)phenyl]carbamoyl]morpholine-4-carboxylate (PubChem CID 166405282) has the molecular formula C19H24FN3O5 and a molecular weight of 393.42 g/mol. Its IUPAC name is tert-butyl 2-[[4-fluoro-3-(prop-2-enoylamino)phenyl]carbamoyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl 2-[[4-fluoro-3-(prop-2-enoylamino)phenyl]carbamoyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 166405282 |
| Molecular Formula | C19H24FN3O5 |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | tert-butyl 2-[[4-fluoro-3-(prop-2-enoylamino)phenyl]carbamoyl]morpholine-4-carboxylate |
| SMILES | C=CC(=O)Nc1cc(NC(=O)C2CN(C(=O)OC(C)(C)C)CCO2)ccc1F |
| InChI | InChI=1S/C19H24FN3O5/c1-5-16(24)22-14-10-12(6-7-13(14)20)21-17(25)15-11-23(8-9-27-15)18(26)28-19(2,3)4/h5-7,10,15H,1,8-9,11H2,2-4H3,(H,21,25)(H,22,24) |
| InChIKey | HKRXCUZDJJEGQW-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|