C19H19N3O3 — CID 172889899
(2S)-4-prop-2-enoyl-N-(4-pyridin-4-ylphenyl)morpholine-2-carboxamide (PubChem CID 172889899) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is (2S)-4-prop-2-enoyl-N-(4-pyridin-4-ylphenyl)morpholine-2-carboxamide.
| Compound Name | (2S)-4-prop-2-enoyl-N-(4-pyridin-4-ylphenyl)morpholine-2-carboxamide |
|---|---|
| PubChem CID | 172889899 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | (2S)-4-prop-2-enoyl-N-(4-pyridin-4-ylphenyl)morpholine-2-carboxamide |
| SMILES | C=CC(=O)N1CCO[C@H](C(=O)Nc2ccc(-c3ccncc3)cc2)C1 |
| InChI | InChI=1S/C19H19N3O3/c1-2-18(23)22-11-12-25-17(13-22)19(24)21-16-5-3-14(4-6-16)15-7-9-20-10-8-15/h2-10,17H,1,11-13H2,(H,21,24)/t17-/m0/s1 |
| InChIKey | NXEZHOGLWMOGTJ-KRWDZBQOSA-N |
| XLogP | 2.10 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|