C16H20FN3O3 — CID 56911131
2-N-cyclobutyl-4-N-(4-fluorophenyl)morpholine-2,4-dicarboxamide (PubChem CID 56911131) has the molecular formula C16H20FN3O3 and a molecular weight of 321.35 g/mol. Its IUPAC name is 2-N-cyclobutyl-4-N-(4-fluorophenyl)morpholine-2,4-dicarboxamide.
| Compound Name | 2-N-cyclobutyl-4-N-(4-fluorophenyl)morpholine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 56911131 |
| Molecular Formula | C16H20FN3O3 |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 2-N-cyclobutyl-4-N-(4-fluorophenyl)morpholine-2,4-dicarboxamide |
| SMILES | O=C(NC1CCC1)C1CN(C(=O)Nc2ccc(F)cc2)CCO1 |
| InChI | InChI=1S/C16H20FN3O3/c17-11-4-6-13(7-5-11)19-16(22)20-8-9-23-14(10-20)15(21)18-12-2-1-3-12/h4-7,12,14H,1-3,8-10H2,(H,18,21)(H,19,22) |
| InChIKey | XVYYWUBHEWKDLX-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |