C12H15FN4O2 — CID 79675785
2-carbamimidoyl-N-(4-fluorophenyl)morpholine-4-carboxamide (PubChem CID 79675785) has the molecular formula C12H15FN4O2 and a molecular weight of 266.28 g/mol. Its IUPAC name is 2-carbamimidoyl-N-(4-fluorophenyl)morpholine-4-carboxamide.
| Compound Name | 2-carbamimidoyl-N-(4-fluorophenyl)morpholine-4-carboxamide |
|---|---|
| PubChem CID | 79675785 |
| Molecular Formula | C12H15FN4O2 |
| Molecular Weight | 266.28 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 2-carbamimidoyl-N-(4-fluorophenyl)morpholine-4-carboxamide |
| SMILES | [H]/N=C(\N)C1CN(C(=O)Nc2ccc(F)cc2)CCO1 |
| InChI | InChI=1S/C12H15FN4O2/c13-8-1-3-9(4-2-8)16-12(18)17-5-6-19-10(7-17)11(14)15/h1-4,10H,5-7H2,(H3,14,15)(H,16,18) |
| InChIKey | NBHITZRUONMTLD-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 91.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.28 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|