C10H18N4O2 — CID 116658982
2-carbamimidoyl-N-cyclobutylmorpholine-4-carboxamide (PubChem CID 116658982) has the molecular formula C10H18N4O2 and a molecular weight of 226.28 g/mol. Its IUPAC name is 2-carbamimidoyl-N-cyclobutylmorpholine-4-carboxamide.
| Compound Name | 2-carbamimidoyl-N-cyclobutylmorpholine-4-carboxamide |
|---|---|
| PubChem CID | 116658982 |
| Molecular Formula | C10H18N4O2 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | 2-carbamimidoyl-N-cyclobutylmorpholine-4-carboxamide |
| SMILES | [H]/N=C(\N)C1CN(C(=O)NC2CCC2)CCO1 |
| InChI | InChI=1S/C10H18N4O2/c11-9(12)8-6-14(4-5-16-8)10(15)13-7-2-1-3-7/h7-8H,1-6H2,(H3,11,12)(H,13,15) |
| InChIKey | FRKCPDDECQYMKW-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 91.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|