C22H24FN3O3 — CID 55698518
2-(4-fluorophenyl)-N-[4-(pyrrolidine-1-carbonyl)phenyl]morpholine-4-carboxamide (PubChem CID 55698518) has the molecular formula C22H24FN3O3 and a molecular weight of 397.45 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-[4-(pyrrolidine-1-carbonyl)phenyl]morpholine-4-carboxamide.
| Compound Name | 2-(4-fluorophenyl)-N-[4-(pyrrolidine-1-carbonyl)phenyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 55698518 |
| Molecular Formula | C22H24FN3O3 |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 2-(4-fluorophenyl)-N-[4-(pyrrolidine-1-carbonyl)phenyl]morpholine-4-carboxamide |
| SMILES | O=C(Nc1ccc(C(=O)N2CCCC2)cc1)N1CCOC(c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C22H24FN3O3/c23-18-7-3-16(4-8-18)20-15-26(13-14-29-20)22(28)24-19-9-5-17(6-10-19)21(27)25-11-1-2-12-25/h3-10,20H,1-2,11-15H2,(H,24,28) |
| InChIKey | IKBLSAGFWPZLPL-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |