C12H15FN4O3 — CID 79681361
N-(3-fluorophenyl)-2-(N'-hydroxycarbamimidoyl)morpholine-4-carboxamide (PubChem CID 79681361) has the molecular formula C12H15FN4O3 and a molecular weight of 282.28 g/mol. Its IUPAC name is N-(3-fluorophenyl)-2-(N'-hydroxycarbamimidoyl)morpholine-4-carboxamide.
| Compound Name | N-(3-fluorophenyl)-2-(N'-hydroxycarbamimidoyl)morpholine-4-carboxamide |
|---|---|
| PubChem CID | 79681361 |
| Molecular Formula | C12H15FN4O3 |
| Molecular Weight | 282.28 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | N-(3-fluorophenyl)-2-(N'-hydroxycarbamimidoyl)morpholine-4-carboxamide |
| SMILES | NC(=NO)C1CN(C(=O)Nc2cccc(F)c2)CCO1 |
| InChI | InChI=1S/C12H15FN4O3/c13-8-2-1-3-9(6-8)15-12(18)17-4-5-20-10(7-17)11(14)16-19/h1-3,6,10,19H,4-5,7H2,(H2,14,16)(H,15,18) |
| InChIKey | WDFRZLHIUOGTAA-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 100.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.28 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|