C12H15N3O4 — CID 79680984
N'-hydroxy-4-(2-hydroxybenzoyl)morpholine-2-carboximidamide (PubChem CID 79680984) has the molecular formula C12H15N3O4 and a molecular weight of 265.27 g/mol. Its IUPAC name is N'-hydroxy-4-(2-hydroxybenzoyl)morpholine-2-carboximidamide.
| Compound Name | N'-hydroxy-4-(2-hydroxybenzoyl)morpholine-2-carboximidamide |
|---|---|
| PubChem CID | 79680984 |
| Molecular Formula | C12H15N3O4 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | N'-hydroxy-4-(2-hydroxybenzoyl)morpholine-2-carboximidamide |
| SMILES | NC(=NO)C1CN(C(=O)c2ccccc2O)CCO1 |
| InChI | InChI=1S/C12H15N3O4/c13-11(14-18)10-7-15(5-6-19-10)12(17)8-3-1-2-4-9(8)16/h1-4,10,16,18H,5-7H2,(H2,13,14) |
| InChIKey | AGWAXLFNIIJPSO-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 108.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|