C8H15N3O3 — CID 79680714
N'-hydroxy-4-propanoylmorpholine-2-carboximidamide (PubChem CID 79680714) has the molecular formula C8H15N3O3 and a molecular weight of 201.23 g/mol. Its IUPAC name is N'-hydroxy-4-propanoylmorpholine-2-carboximidamide.
| Compound Name | N'-hydroxy-4-propanoylmorpholine-2-carboximidamide |
|---|---|
| PubChem CID | 79680714 |
| Molecular Formula | C8H15N3O3 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.11 |
| IUPAC Name | N'-hydroxy-4-propanoylmorpholine-2-carboximidamide |
| SMILES | CCC(=O)N1CCOC(C(N)=NO)C1 |
| InChI | InChI=1S/C8H15N3O3/c1-2-7(12)11-3-4-14-6(5-11)8(9)10-13/h6,13H,2-5H2,1H3,(H2,9,10) |
| InChIKey | PGHOFFQZFNUSSB-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|