C10H12IN3O3S — CID 79683526
N'-hydroxy-4-(5-iodothiophene-3-carbonyl)morpholine-2-carboximidamide (PubChem CID 79683526) has the molecular formula C10H12IN3O3S and a molecular weight of 381.20 g/mol. Its IUPAC name is N'-hydroxy-4-(5-iodothiophene-3-carbonyl)morpholine-2-carboximidamide.
| Compound Name | N'-hydroxy-4-(5-iodothiophene-3-carbonyl)morpholine-2-carboximidamide |
|---|---|
| PubChem CID | 79683526 |
| Molecular Formula | C10H12IN3O3S |
| Molecular Weight | 381.20 g/mol |
| Exact Mass | 380.96 |
| IUPAC Name | N'-hydroxy-4-(5-iodothiophene-3-carbonyl)morpholine-2-carboximidamide |
| SMILES | NC(=NO)C1CN(C(=O)c2csc(I)c2)CCO1 |
| InChI | InChI=1S/C10H12IN3O3S/c11-8-3-6(5-18-8)10(15)14-1-2-17-7(4-14)9(12)13-16/h3,5,7,16H,1-2,4H2,(H2,12,13) |
| InChIKey | MBULZXHNWLELEK-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.20 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|