C12H17N3O2 — CID 51530238
(2S)-4-benzyl-N'-hydroxymorpholine-2-carboximidamide (PubChem CID 51530238) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is (2S)-4-benzyl-N'-hydroxymorpholine-2-carboximidamide.
| Compound Name | (2S)-4-benzyl-N'-hydroxymorpholine-2-carboximidamide |
|---|---|
| PubChem CID | 51530238 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | (2S)-4-benzyl-N'-hydroxymorpholine-2-carboximidamide |
| SMILES | N/C(=N\O)[C@@H]1CN(Cc2ccccc2)CCO1 |
| InChI | InChI=1S/C12H17N3O2/c13-12(14-16)11-9-15(6-7-17-11)8-10-4-2-1-3-5-10/h1-5,11,16H,6-9H2,(H2,13,14)/t11-/m0/s1 |
| InChIKey | WXNVXEDYZMJYOG-NSHDSACASA-N |
| XLogP | 0.63 |
| TPSA | 71.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|