About [(2S)-4-benzylmorpholin-2-yl]-phenylmethanone;(4-benzylmorpholin-2-yl)-phenylmethanone
[(2S)-4-benzylmorpholin-2-yl]-phenylmethanone;(4-benzylmorpholin-2-yl)-phenylmethanone (PubChem CID 158902777) has the molecular formula C36H38N2O4
and a molecular weight of 562.71 g/mol. Its IUPAC name is [(2S)-4-benzylmorpholin-2-yl]-phenylmethanone;(4-benzylmorpholin-2-yl)-phenylmethanone.
Molecular Properties
| Compound Name | [(2S)-4-benzylmorpholin-2-yl]-phenylmethanone;(4-benzylmorpholin-2-yl)-phenylmethanone |
| PubChem CID | 158902777 |
| Molecular Formula | C36H38N2O4 |
| Molecular Weight | 562.71 g/mol |
| Exact Mass | 562.28 |
| IUPAC Name | [(2S)-4-benzylmorpholin-2-yl]-phenylmethanone;(4-benzylmorpholin-2-yl)-phenylmethanone |
| SMILES | O=C(c1ccccc1)C1CN(Cc2ccccc2)CCO1.O=C(c1ccccc1)[C@@H]1CN(Cc2ccccc2)CCO1 |
| InChI | InChI=1S/2C18H19NO2/c2*20-18(16-9-5-2-6-10-16)17-14-19(11-12-21-17)13-15-7-3-1-4-8-15/h2*1-10,17H,11-14H2/t17-;/m0./s1 |
| InChIKey | JFQUCBUHMYCEOU-LMOVPXPDSA-N |
| XLogP | 5.54 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 562.71 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [(2S)-4-benzylmorpholin-2-yl]-phenylmethanone;(4-benzylmorpholin-2-yl)-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-4-benzylmorpholin-2-yl]-phenylmethanone;(4-benzylmorpholin-2-yl)-phenylmethanone?
The IUPAC name of [(2S)-4-benzylmorpholin-2-yl]-phenylmethanone;(4-benzylmorpholin-2-yl)-phenylmethanone (CID 158902777) is [(2S)-4-benzylmorpholin-2-yl]-phenylmethanone;(4-benzylmorpholin-2-yl)-phenylmethanone.
What is the SMILES notation for [(2S)-4-benzylmorpholin-2-yl]-phenylmethanone;(4-benzylmorpholin-2-yl)-phenylmethanone?
The canonical SMILES for [(2S)-4-benzylmorpholin-2-yl]-phenylmethanone;(4-benzylmorpholin-2-yl)-phenylmethanone is O=C(c1ccccc1)C1CN(Cc2ccccc2)CCO1.O=C(c1ccccc1)[C@@H]1CN(Cc2ccccc2)CCO1.
What is the InChIKey of [(2S)-4-benzylmorpholin-2-yl]-phenylmethanone;(4-benzylmorpholin-2-yl)-phenylmethanone?
The InChIKey is JFQUCBUHMYCEOU-LMOVPXPDSA-N. The full InChI is InChI=1S/2C18H19NO2/c2*20-18(16-9-5-2-6-10-16)17-14-19(11-12-21-17)13-15-7-3-1-4-8-15/h2*1-10,17H,11-14H2/t17-;/m0./s1.
What are the key properties of [(2S)-4-benzylmorpholin-2-yl]-phenylmethanone;(4-benzylmorpholin-2-yl)-phenylmethanone?
[(2S)-4-benzylmorpholin-2-yl]-phenylmethanone;(4-benzylmorpholin-2-yl)-phenylmethanone has a molecular weight of 562.71 g/mol, XLogP of 5.54, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-4-benzylmorpholin-2-yl]-phenylmethanone;(4-benzylmorpholin-2-yl)-phenylmethanone is sourced from PubChem (CID 158902777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).