C19H28N2O2 — CID 97023605
[(2S)-4-benzylmorpholin-2-yl]-[(4R)-4-methylazepan-1-yl]methanone (PubChem CID 97023605) has the molecular formula C19H28N2O2 and a molecular weight of 316.44 g/mol. Its IUPAC name is [(2S)-4-benzylmorpholin-2-yl]-[(4R)-4-methylazepan-1-yl]methanone.
| Compound Name | [(2S)-4-benzylmorpholin-2-yl]-[(4R)-4-methylazepan-1-yl]methanone |
|---|---|
| PubChem CID | 97023605 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | [(2S)-4-benzylmorpholin-2-yl]-[(4R)-4-methylazepan-1-yl]methanone |
| SMILES | C[C@@H]1CCCN(C(=O)[C@@H]2CN(Cc3ccccc3)CCO2)CC1 |
| InChI | InChI=1S/C19H28N2O2/c1-16-6-5-10-21(11-9-16)19(22)18-15-20(12-13-23-18)14-17-7-3-2-4-8-17/h2-4,7-8,16,18H,5-6,9-15H2,1H3/t16-,18+/m1/s1 |
| InChIKey | CSDCIZVAPJPMLB-AEFFLSMTSA-N |
| XLogP | 2.54 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |