C18H25N3O3 — CID 136527577
1-(4-benzylmorpholine-2-carbonyl)-N-methylpyrrolidine-2-carboxamide (PubChem CID 136527577) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is 1-(4-benzylmorpholine-2-carbonyl)-N-methylpyrrolidine-2-carboxamide.
| Compound Name | 1-(4-benzylmorpholine-2-carbonyl)-N-methylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 136527577 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 1-(4-benzylmorpholine-2-carbonyl)-N-methylpyrrolidine-2-carboxamide |
| SMILES | CNC(=O)C1CCCN1C(=O)C1CN(Cc2ccccc2)CCO1 |
| InChI | InChI=1S/C18H25N3O3/c1-19-17(22)15-8-5-9-21(15)18(23)16-13-20(10-11-24-16)12-14-6-3-2-4-7-14/h2-4,6-7,15-16H,5,8-13H2,1H3,(H,19,22) |
| InChIKey | IVJACKCVJKZAGJ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |