C18H27N3O2 — CID 120572360
(4-benzylmorpholin-2-yl)-(2,3-dimethylpiperazin-1-yl)methanone (PubChem CID 120572360) has the molecular formula C18H27N3O2 and a molecular weight of 317.43 g/mol. Its IUPAC name is (4-benzylmorpholin-2-yl)-(2,3-dimethylpiperazin-1-yl)methanone.
| Compound Name | (4-benzylmorpholin-2-yl)-(2,3-dimethylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 120572360 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | (4-benzylmorpholin-2-yl)-(2,3-dimethylpiperazin-1-yl)methanone |
| SMILES | CC1NCCN(C(=O)C2CN(Cc3ccccc3)CCO2)C1C |
| InChI | InChI=1S/C18H27N3O2/c1-14-15(2)21(9-8-19-14)18(22)17-13-20(10-11-23-17)12-16-6-4-3-5-7-16/h3-7,14-15,17,19H,8-13H2,1-2H3 |
| InChIKey | GFCRRODGPCWTLW-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |