C23H31Cl2N3O3 — CID 120732756
(4-benzylmorpholin-2-yl)-[2-(2-methoxyphenyl)piperazin-1-yl]methanone;dihydrochloride (PubChem CID 120732756) has the molecular formula C23H31Cl2N3O3 and a molecular weight of 468.43 g/mol. Its IUPAC name is (4-benzylmorpholin-2-yl)-[2-(2-methoxyphenyl)piperazin-1-yl]methanone;dihydrochloride.
| Compound Name | (4-benzylmorpholin-2-yl)-[2-(2-methoxyphenyl)piperazin-1-yl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 120732756 |
| Molecular Formula | C23H31Cl2N3O3 |
| Molecular Weight | 468.43 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | (4-benzylmorpholin-2-yl)-[2-(2-methoxyphenyl)piperazin-1-yl]methanone;dihydrochloride |
| SMILES | COc1ccccc1C1CNCCN1C(=O)C1CN(Cc2ccccc2)CCO1.Cl.Cl |
| InChI | InChI=1S/C23H29N3O3.2ClH/c1-28-21-10-6-5-9-19(21)20-15-24-11-12-26(20)23(27)22-17-25(13-14-29-22)16-18-7-3-2-4-8-18;;/h2-10,20,22,24H,11-17H2,1H3;2*1H |
| InChIKey | RGJKRCPOJOLSCH-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.43 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |