C16H23N3O3 — CID 155974237
1-methyl-4-[[2-(pyrrolidine-1-carbonyl)morpholin-4-yl]methyl]pyridin-2-one (PubChem CID 155974237) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is 1-methyl-4-[[2-(pyrrolidine-1-carbonyl)morpholin-4-yl]methyl]pyridin-2-one.
| Compound Name | 1-methyl-4-[[2-(pyrrolidine-1-carbonyl)morpholin-4-yl]methyl]pyridin-2-one |
|---|---|
| PubChem CID | 155974237 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 1-methyl-4-[[2-(pyrrolidine-1-carbonyl)morpholin-4-yl]methyl]pyridin-2-one |
| SMILES | Cn1ccc(CN2CCOC(C(=O)N3CCCC3)C2)cc1=O |
| InChI | InChI=1S/C16H23N3O3/c1-17-7-4-13(10-15(17)20)11-18-8-9-22-14(12-18)16(21)19-5-2-3-6-19/h4,7,10,14H,2-3,5-6,8-9,11-12H2,1H3 |
| InChIKey | NRZIVCHPPPYRQK-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |