C15H21N3O2 — CID 155800017
[4-(pyridin-3-ylmethyl)morpholin-2-yl]-pyrrolidin-1-ylmethanone (PubChem CID 155800017) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is [4-(pyridin-3-ylmethyl)morpholin-2-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [4-(pyridin-3-ylmethyl)morpholin-2-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 155800017 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | [4-(pyridin-3-ylmethyl)morpholin-2-yl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C(C1CN(Cc2cccnc2)CCO1)N1CCCC1 |
| InChI | InChI=1S/C15H21N3O2/c19-15(18-6-1-2-7-18)14-12-17(8-9-20-14)11-13-4-3-5-16-10-13/h3-5,10,14H,1-2,6-9,11-12H2 |
| InChIKey | YDZNXVOGNXPWFK-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |