C16H20F3NO2 — CID 59789274
1-(4-benzylmorpholin-2-yl)-5,5,5-trifluoropentan-1-one (PubChem CID 59789274) has the molecular formula C16H20F3NO2 and a molecular weight of 315.33 g/mol. Its IUPAC name is 1-(4-benzylmorpholin-2-yl)-5,5,5-trifluoropentan-1-one.
| Compound Name | 1-(4-benzylmorpholin-2-yl)-5,5,5-trifluoropentan-1-one |
|---|---|
| PubChem CID | 59789274 |
| Molecular Formula | C16H20F3NO2 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 1-(4-benzylmorpholin-2-yl)-5,5,5-trifluoropentan-1-one |
| SMILES | O=C(CCCC(F)(F)F)C1CN(Cc2ccccc2)CCO1 |
| InChI | InChI=1S/C16H20F3NO2/c17-16(18,19)8-4-7-14(21)15-12-20(9-10-22-15)11-13-5-2-1-3-6-13/h1-3,5-6,15H,4,7-12H2 |
| InChIKey | VEFUFHUXFCSTLG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |