C10H16F3NO2 — CID 79666251
1-(4-ethylmorpholin-2-yl)-4,4,4-trifluorobutan-1-one (PubChem CID 79666251) has the molecular formula C10H16F3NO2 and a molecular weight of 239.24 g/mol. Its IUPAC name is 1-(4-ethylmorpholin-2-yl)-4,4,4-trifluorobutan-1-one.
| Compound Name | 1-(4-ethylmorpholin-2-yl)-4,4,4-trifluorobutan-1-one |
|---|---|
| PubChem CID | 79666251 |
| Molecular Formula | C10H16F3NO2 |
| Molecular Weight | 239.24 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 1-(4-ethylmorpholin-2-yl)-4,4,4-trifluorobutan-1-one |
| SMILES | CCN1CCOC(C(=O)CCC(F)(F)F)C1 |
| InChI | InChI=1S/C10H16F3NO2/c1-2-14-5-6-16-9(7-14)8(15)3-4-10(11,12)13/h9H,2-7H2,1H3 |
| InChIKey | VLHSCDGOZJMYGA-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.24 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |