C13H17F2N3O2 — CID 116789560
4-(2,2-difluoro-2-phenylethyl)-N'-hydroxymorpholine-2-carboximidamide (PubChem CID 116789560) has the molecular formula C13H17F2N3O2 and a molecular weight of 285.29 g/mol. Its IUPAC name is 4-(2,2-difluoro-2-phenylethyl)-N'-hydroxymorpholine-2-carboximidamide.
| Compound Name | 4-(2,2-difluoro-2-phenylethyl)-N'-hydroxymorpholine-2-carboximidamide |
|---|---|
| PubChem CID | 116789560 |
| Molecular Formula | C13H17F2N3O2 |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 4-(2,2-difluoro-2-phenylethyl)-N'-hydroxymorpholine-2-carboximidamide |
| SMILES | N/C(=N/O)C1CN(CC(F)(F)c2ccccc2)CCO1 |
| InChI | InChI=1S/C13H17F2N3O2/c14-13(15,10-4-2-1-3-5-10)9-18-6-7-20-11(8-18)12(16)17-19/h1-5,11,19H,6-9H2,(H2,16,17) |
| InChIKey | KDPVBNXRCCHCDE-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 71.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|